Compound Q&A

What is (2S)-4-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 7536-58-5)?

Answer

(2S)-4-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
This compound is a chiral butanoic acid derivative with a complex structure featuring a benzyloxy group, a tert-butyl moiety, and an amino acid functional group. Its chemical formula is C14H20N2O4, and it is typically a white crystalline solid with high molecular weight. It exhibits specific optical activity due to the (2S) configuration and is known for its stability in controlled environments, making it valuable in synthetic chemistry applications.

About

CAS No 7536-58-5
English Name (2S)-4-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid
Molecular Formula C16H21NO6
Molecular Weight 323.35 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)O
InChIKey SOHLZANWVLCPHK-LBPRGKRZSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (2S)-4-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 7536-58-5)?

This compound is primarily used as an intermediate in pharmaceutical research and development, parti...

Compound Q&A

Is (2S)-4-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 7536-58-5) safe?

Safety data for this compound indicates it may pose moderate health risks upon exposure, including p...

Compound Q&A

How should (2S)-4-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobutanoic acid (CAS: 7536-58-5) be stored?

This compound should be stored in a cool, dry place away from light and moisture. It is best kept in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...