Compound Q&A

What are the main uses of (2R,3R)-3-(2,5-Difluorophenyl)-3-hydroxy-2-methyl-4-(1H-1,2,4-triazol-1-yl)butanethioamide (CAS: 368421-58-3)?

Answer

(2R,3R)-3-(2,5-Difluorophenyl)-3-hydroxy-2-methyl-4-(1H-1,2,4-triazol-1-yl)butanethioamide
This compound is primarily used in pharmaceutical research for its potential as a bioactive agent. It may serve as a scaffold for drug development due to its structural features. Additionally, it is used in organic synthesis and chemical research for its reactivity and ability to form various derivatives. Its applications are largely limited to specialized laboratories and research settings.

About

English Name (2R,3R)-3-(2,5-Difluorophenyl)-3-hydroxy-2-methyl-4-(1H-1,2,4-triazol-1-yl)butanethioamide
Molecular Formula C13H14F2N4OS
Molecular Weight 312.34 g/mol
SMILES S=C(N)[C@H](C)[C@@](O)(C1=CC(F)=CC=C1F)CN2N=CN=C2
InChIKey UWVOPVUWKIHGRF-ISVAXAHUSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is (2R,3R)-3-(2,5-Difluorophenyl)-3-hydroxy-2-methyl-4-(1H-1,2,4-triazol-1-yl)butanethioamide (CAS: 368421-58-3)?

This compound, with the CAS number 368421-58-3, is a thiourea derivative containing a 1H-1,2,4-triaz...

Compound Q&A

Is (2R,3R)-3-(2,5-Difluorophenyl)-3-hydroxy-2-methyl-4-(1H-1,2,4-triazol-1-yl)butanethioamide (CAS: 368421-58-3) safe?

Safety of this compound is primarily determined by its handling and usage conditions. It should be t...

Compound Q&A

How should (2R,3R)-3-(2,5-Difluorophenyl)-3-hydroxy-2-methyl-4-(1H-1,2,4-triazol-1-yl)butanethioamide (CAS: 368421-58-3) be stored?

This compound should be stored in a cool, dry, and dark place to maintain its stability. It is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...