Compound Q&A

What is 4,4'-Oxydibenzoic acid (CAS: 2215-89-6)?

Answer

4,4'-Oxydibenzoic acid
4,4'-Oxydibenzoic acid (CAS: 2215-89-6) is an organic compound with the chemical formula C14H10O4. It consists of two benzene rings connected by an oxygen bridge, each bearing a carboxylic acid group. This compound is a white crystalline solid with high melting point and is commonly used as a precursor in chemical synthesis. Its structure makes it valuable in creating complex molecules for various applications.

About

CAS No 2215-89-6
English Name 4,4'-Oxydibenzoic acid
Molecular Formula C14H10O5
Molecular Weight 258.23 g/mol
SMILES C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)C(=O)O
InChIKey WVDRSXGPQWNUBN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 4,4'-Oxydibenzoic acid (CAS: 2215-89-6)?

4,4'-Oxydibenzoic acid (CAS: 2215-89-6) is primarily used in pharmaceuticals as an intermediate for ...

Compound Q&A

Is 4,4'-Oxydibenzoic acid (CAS: 2215-89-6) safe?

4,4'-Oxydibenzoic acid (CAS: 2215-89-6) is generally considered safe when handled properly. However,...

Compound Q&A

How should 4,4'-Oxydibenzoic acid (CAS: 2215-89-6) be stored?

4,4'-Oxydibenzoic acid (CAS: 2215-89-6) should be stored in a cool, dry place, away from direct ligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...