Compound Q&A

What is benzyltriphenylphosphanium bromide (CAS: 1449-46-3)?

Answer

benzyltriphenylphosphanium bromide
Benzyltriphenylphosphanium bromide (CAS: 1449-46-3) is an organophosphorus compound with the chemical formula C29H27BrP. It is a quaternary phosphonium salt characterized by its stability in organic solvents and role as a versatile catalyst in chemical reactions. The compound is commonly used in synthetic chemistry due to its ability to facilitate various reactions, including coupling processes and functional group transformations.

About

CAS No 1449-46-3
English Name benzyltriphenylphosphanium bromide
Molecular Formula C25H22BrP
Molecular Weight 433.3 g/mol
SMILES C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-]
InChIKey WTEPWWCRWNCUNA-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of benzyltriphenylphosphanium bromide (CAS: 1449-46-3)?

Benzyltriphenylphosphanium bromide (CAS: 1449-46-3) is primarily employed in pharmaceuticals for dru...

Compound Q&A

Is benzyltriphenylphosphanium bromide (CAS: 1449-46-3) safe?

Benzyltriphenylphosphanium bromide (CAS: 1449-46-3) is generally considered safe when handled proper...

Compound Q&A

How should benzyltriphenylphosphanium bromide (CAS: 1449-46-3) be stored?

Benzyltriphenylphosphanium bromide (CAS: 1449-46-3) should be stored in a cool, dry place, away from...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...