Compound Q&A

What are the main uses of 2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5)?

Answer

2,7-Dibromo-9H-fluoren-9-one
2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5) finds applications in pharmaceutical research, materials science, and chemical synthesis. It serves as a key intermediate in the development of drugs, dyes, and functional materials. Its unique structure also makes it valuable for studying reaction mechanisms and creating derivatives with tailored properties.

About

CAS No 14348-75-5
English Name 2,7-Dibromo-9H-fluoren-9-one
Molecular Formula C13H6Br2O
Molecular Weight 338 g/mol
SMILES C1=CC2=C(C=C1Br)C(=O)C3=C2C=CC(=C3)Br
InChIKey CWGRCRZFJOXQFV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5)?

2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5) is an organic compound with the chemical formula C13H...

Compound Q&A

Is 2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5) safe?

2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5) requires careful handling due to potential toxicity. ...

Compound Q&A

How should 2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5) be stored?

2,7-Dibromo-9H-fluoren-9-one (CAS: 14348-75-5) should be stored in a sealed, light-resistant contain...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...