Compound Q&A

What is 2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4)?

Answer

2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate
2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4) is a multifunctional methacrylate monomer used in polymer chemistry. It has the chemical formula C14H20O5 and is known for its ability to form cross-linked networks. This compound is characterized by its high reactivity and compatibility with various polymerization processes, making it valuable in the development of advanced materials.

About

CAS No 3290-92-4
English Name 2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate
Molecular Formula C18H26O6
Molecular Weight 338.4 g/mol
SMILES CC(C(OCC(COC(C(C)=C)=O)(CC)COC(C(C)=C)=O)=O)=C
InChIKey OKKRPWIIYQTPQF-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4)?

2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4) is primarily used in the synthes...

Compound Q&A

Is 2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4) safe?

2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4) is generally considered safe whe...

Compound Q&A

How should 2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4) be stored?

2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate (CAS: 3290-92-4) should be stored in a cool, dry,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...