Compound Q&A

Is 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0) safe?

Answer

4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid
4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0) is generally considered safe when handled properly, but it requires standard chemical safety precautions. As a carboxylic acid derivative, it may exhibit mild irritancy, so protective equipment like gloves and goggles is recommended. Safety data sheets (SDS) should be consulted for specific guidelines, and it is typically regulated under chemical safety standards for laboratory and industrial use.

About

English Name 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid
Molecular Formula C12H14N2O2
Molecular Weight 218.26 g/mol
SMILES CCCC1=NC2=C(N1)C=C(C=C2C)C(=O)O
InChIKey XWAJTVCEILFDGU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0)?

4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0) is a heterocyclic compound c...

Compound Q&A

What are the main uses of 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0)?

4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0) is primarily used in pharmac...

Compound Q&A

How should 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0) be stored?

4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic acid (CAS: 152628-03-0) should be stored in a cool, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...