Compound Q&A

What is 4-Nitro-o-phenylenediamine (CAS: 99-56-9)?

Answer

4-Nitro-o-phenylenediamine
4-Nitro-o-phenylenediamine (CAS: 99-56-9) is an organic aromatic compound with the molecular formula C6H6N4O2. It features a benzene ring substituted with two amino groups (NH2) at the ortho positions and a nitro group (NO2) at the 4th position. This compound is typically a yellow solid, known for its reactivity and use in chemical synthesis. Its structural characteristics make it a key intermediate in various industrial and research applications.

About

CAS No 99-56-9
English Name 4-Nitro-o-phenylenediamine
Molecular Formula C6H7N3O2
Molecular Weight 153.14 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])N)N
InChIKey RAUWPNXIALNKQM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 4-Nitro-o-phenylenediamine (CAS: 99-56-9)?

4-Nitro-o-phenylenediamine (CAS: 99-56-9) is primarily used in the pharmaceutical industry as a prec...

Compound Q&A

Is 4-Nitro-o-phenylenediamine (CAS: 99-56-9) safe?

4-Nitro-o-phenylenediamine (CAS: 99-56-9) is not considered safe for direct handling due to its pote...

Compound Q&A

How should 4-Nitro-o-phenylenediamine (CAS: 99-56-9) be stored?

4-Nitro-o-phenylenediamine (CAS: 99-56-9) should be stored in a cool, dry place (ideally 20-25°C), a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...