Compound Q&A

What are the main uses of 2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1)?

Answer

2-Isopropyl-9H-thioxanthen-9-one
2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1) is primarily used in pharmaceutical research as a synthetic intermediate for drug development. It also finds applications in industrial chemistry for producing dyes, coatings, and UV-absorbing materials. In research settings, it serves as a model compound for studying photochemical reactivity and molecular structure. Its unique thioxanthone framework makes it valuable in creating bioactive molecules and polymers.

About

CAS No 5495-84-1
English Name 2-Isopropyl-9H-thioxanthen-9-one
Molecular Formula C16H14OS
Molecular Weight 254.35 g/mol
SMILES CC(C)c1ccc2c(c1)c(=O)c3ccccc3s2
InChIKey KTALPKYXQZGAEG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1)?

2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1) is an organic compound belonging to the thioxantho...

Compound Q&A

Is 2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1) safe?

2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1) is generally considered safe when handled properly...

Compound Q&A

How should 2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1) be stored?

2-Isopropyl-9H-thioxanthen-9-one (CAS: 5495-84-1) should be stored in a sealed, airtight container i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...