Compound Q&A

What is Trioctyl Trimellitate (CAS: 3319-31-1)?

Answer

Trioctyl trimellitate (TOTM), with the CAS number 3319-31-1, is a triester of trimellitic acid and octyl alcohol. It is a colorless, odorless liquid with high thermal stability and is commonly used as a plasticizer in various industrial applications. TOTM has a molecular formula of C24H46O7 and is known for its non-toxic and non-volatile properties, making it suitable for use in flexible materials and coatings.

About

CAS No 3319-31-1

English Name Trioctyl Trimellitate

Molecular Formula C33H54O6

Molecular Weight 546.7890000000004 g/mol

SMILES O=C(C1=CC=C(C(OCCCCCCCC)=O)C=C1C(OCCCCCCCC)=O)OCCCCCCCC

InChIKey JNXDCMUUZNIWPQ-UHFFFAOYSA-N

Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Trioctyl Trimellitate (CAS: 3319-31-1)?

Trioctyl trimellitate (TOTM) is widely used as a plasticizer in the production of polyvinyl chloride...

Compound Q&A

Is Trioctyl Trimellitate (CAS: 3319-31-1) safe?

Trioctyl trimellitate (TOTM) is considered safe when handled properly and used within recommended gu...

Compound Q&A

How should Trioctyl Trimellitate (CAS: 3319-31-1) be stored?

Trioctyl trimellitate (TOTM) should be stored in a cool, dry, and well-ventilated area, away from di...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is Trioctyl Trimellitate (CAS: 3319-31-1)?

Answer

About

Related Q&A

What are the main uses of Trioctyl Trimellitate (CAS: 3319-31-1)?

Is Trioctyl Trimellitate (CAS: 3319-31-1) safe?

How should Trioctyl Trimellitate (CAS: 3319-31-1) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Hubei Hanwei Chemical Co., Ltd.

HuBeiAnAo Biotechnology Co Ltd

Guangdong Wanzhang Chemical Reagent Co., Ltd.

TianJinShiHengXingHuaGongMaoYiGongSi

Hubei Rike Chemical Co., Ltd.

Shanghai Jiubang Chemical Co., Ltd.