Compound Q&A

What are the main uses of 2,6-dichloro-3-nitro-pyridine (CAS: 16013-85-7)?

Answer

2,6-dichloro-3-nitro-pyridine
2,6-Dichloro-3-nitro-pyridine (CAS: 16013-85-7) is primarily used in the pharmaceutical industry as a building block for the synthesis of drugs targeting various diseases. It also finds application in agrochemicals and dyes. Additionally, it is used in research for the development of new chemical compounds and materials due to its versatile functional groups and reactivity.

About

CAS No 16013-85-7
English Name 2,6-dichloro-3-nitro-pyridine
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.98 g/mol
SMILES C1=CC(=NC(=C1[N+](=O)[O-])Cl)Cl
InChIKey SHCWQWRTKPNTEM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2,6-dichloro-3-nitro-pyridine (CAS: 16013-85-7)?

2,6-Dichloro-3-nitro-pyridine (CAS: 16013-85-7) is an organic compound containing a pyridine ring wi...

Compound Q&A

Is 2,6-dichloro-3-nitro-pyridine (CAS: 16013-85-7) safe?

2,6-Dichloro-3-nitro-pyridine (CAS: 16013-85-7) is considered hazardous and requires careful handlin...

Compound Q&A

How should 2,6-dichloro-3-nitro-pyridine (CAS: 16013-85-7) be stored?

2,6-Dichloro-3-nitro-pyridine (CAS: 16013-85-7) should be stored in a cool, dry, and dark place, awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...