Compound Q&A

What is (11beta)-11-[4-(Dimethylamino)phenyl]-3,20-dioxo-19-norpregna-4,9-dien-17-yl acetate (CAS: 126784-99-4)?

Answer

(11beta)-11-[4-(Dimethylamino)phenyl]-3,20-dioxo-19-norpregna-4,9-dien-17-yl acetate
This compound is a synthetic steroid derivative with the chemical formula C23H33NO5. It exhibits structural features of pregnenolone, including two ketone groups and a dimethylamino benzene ring. Its molecular weight is approximately 387.52 g/mol, and it is typically a white to off-white crystalline solid with solubility in organic solvents. The compound is known for its potential biological activity and is used in various scientific applications.

About

English Name (11beta)-11-[4-(Dimethylamino)phenyl]-3,20-dioxo-19-norpregna-4,9-dien-17-yl acetate
Molecular Formula C30H37NO4
Molecular Weight 475.63 g/mol
SMILES CC(=O)C1(CCC2C1(CC(C3=C4CCC(=O)C=C4CCC23)C5=CC=C(C=C5)N(C)C)C)OC(=O)C
InChIKey OOLLAFOLCSJHRE-ZHAKMVSLSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (11beta)-11-[4-(Dimethylamino)phenyl]-3,20-dioxo-19-norpregna-4,9-dien-17-yl acetate (CAS: 126784-99-4)?

This compound is primarily used in pharmaceutical research as a potential therapeutic agent. It may ...

Compound Q&A

Is (11beta)-11-[4-(Dimethylamino)phenyl]-3,20-dioxo-19-norpregna-4,9-dien-17-yl acetate (CAS: 126784-99-4) safe?

Safety data for this compound is limited, but it is generally considered to have low acute toxicity ...

Compound Q&A

How should (11beta)-11-[4-(Dimethylamino)phenyl]-3,20-dioxo-19-norpregna-4,9-dien-17-yl acetate (CAS: 126784-99-4) be stored?

This compound should be stored in a cool, dry, and dark place at a temperature between 2°C to 8°C. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...