Compound Q&A

What are the main uses of Titanium(2+) 1-butanolate (1:2) (CAS: 5593-70-4)?

Answer

Titanium(2+) 1-butanolate (1:2)
Titanium(2+) 1-butanolate (1:2) is primarily used in the synthesis of titanium-based compounds and as a catalyst in various chemical reactions. It finds applications in pharmaceutical research, materials science, and industrial processes where titanium derivatives are required. Its utility also extends to organic chemistry for functional group transformations and polymer synthesis.

About

CAS No 5593-70-4
English Name Titanium(2+) 1-butanolate (1:2)
Molecular Formula C16H36O4Ti2
Molecular Weight 340.33 g/mol
SMILES CCCCO[Ti](OCCCC)(OCCCC)OCCCC
InChIKey DLNIVGYQXIWPEV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Titanium(2+) 1-butanolate (1:2) (CAS: 5593-70-4)?

Titanium(2+) 1-butanolate (1:2) is a coordination compound with the chemical formula Ti(C4H9)2O2. It...

Compound Q&A

Is Titanium(2+) 1-butanolate (1:2) (CAS: 5593-70-4) safe?

Titanium(2+) 1-butanolate (1:2) is generally considered safe when handled properly, but it should be...

Compound Q&A

How should Titanium(2+) 1-butanolate (1:2) (CAS: 5593-70-4) be stored?

Titanium(2+) 1-butanolate (1:2) should be stored in a cool, dry, and dark place. It is typically kep...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...