Compound Q&A

What are the main uses of 3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6)?

Answer

3',5-Diallyl-2,4'-biphenyldiol
3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6) is primarily utilized in pharmaceutical research as a potential antioxidant and anti-inflammatory agent. It also finds applications in industrial chemistry for material synthesis and in food science as a natural additive. Additionally, it serves as a key intermediate in the development of bioactive compounds and organic synthesis studies.

About

CAS No 35354-74-6
English Name 3',5-Diallyl-2,4'-biphenyldiol
Molecular Formula C18H18O2
Molecular Weight 266.34 g/mol
SMILES Oc1ccc(cc1CC=C)c2cc(CC=C)ccc2O
InChIKey FVYXIJYOAGAUQK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6)?

3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6) is a synthetic organic compound with the chemical f...

Compound Q&A

Is 3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6) safe?

3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6) is generally considered safe when handled properly,...

Compound Q&A

How should 3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6) be stored?

3',5-Diallyl-2,4'-biphenyldiol (CAS: 35354-74-6) should be stored in a sealed, airtight container in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...