Compound Q&A

What is 1-Deoxy-1-(methylamino)-D-glucitol (CAS: 6284-40-8)?

Answer

1-Deoxy-1-(methylamino)-D-glucitol
1-Deoxy-1-(methylamino)-D-glucitol is a synthetic compound with the chemical formula C7H15NO5. It is a derivative of D-glucitol, featuring a methylamino group at the 1-position and lacking an oxygen atom. This compound is known for its structural similarity to sugars and is often used in various chemical and biological applications.

About

CAS No 6284-40-8
English Name 1-Deoxy-1-(methylamino)-D-glucitol
Molecular Formula C7H17NO5
Molecular Weight 195.22 g/mol
SMILES OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CNC
InChIKey MBBZMMPHUWSWHV-BDVNFPICSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 1-Deoxy-1-(methylamino)-D-glucitol (CAS: 6284-40-8)?

1-Deoxy-1-(methylamino)-D-glucitol is primarily used in pharmaceutical research as a potential precu...

Compound Q&A

Is 1-Deoxy-1-(methylamino)-D-glucitol (CAS: 6284-40-8) safe?

1-Deoxy-1-(methylamino)-D-glucitol is generally considered safe when handled properly. However, as w...

Compound Q&A

How should 1-Deoxy-1-(methylamino)-D-glucitol (CAS: 6284-40-8) be stored?

1-Deoxy-1-(methylamino)-D-glucitol should be stored in a cool, dry, and dark place to maintain stabi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...