Compound Q&A

What are the main uses of Uridine (CAS: 58-96-8)?

Answer

Uridine
Uridine is widely used in pharmaceuticals for its potential therapeutic applications, including antiviral and anticancer treatments. It also finds use in food supplements and research for studying metabolic pathways and genetic material. Additionally, it serves as a precursor in the synthesis of other nucleotides and is applied in industrial processes for chemical manufacturing.

About

CAS No 58-96-8
English Name Uridine
Molecular Formula C9H12N2O6
Molecular Weight 244.203 g/mol
SMILES OC[C@@H]1[C@H]([C@H]([C@H](N2C(NC(C=C2)=O)=O)O1)O)O
InChIKey DRTQHJPVMGBUCF-XVFCMESISA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Uridine (CAS: 58-96-8)?

Uridine is a nucleoside composed of uracil and ribose. It is a white crystalline powder that is solu...

Compound Q&A

Is Uridine (CAS: 58-96-8) safe?

Uridine is generally considered safe when used in appropriate amounts and under proper handling cond...

Compound Q&A

How should Uridine (CAS: 58-96-8) be stored?

Uridine should be stored in a cool, dry place away from light. It is typically kept in airtight cont...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...