Compound Q&A

What are the main uses of 2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3)?

Answer

2-(Hydroxymethyl)phenyl beta-D-glucopyranoside
2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3) is primarily used in pharmaceutical research as a building block for developing drugs, particularly in the synthesis of bioactive compounds and glycosylated derivatives. It also finds applications in organic chemistry for its utility in glycosylation reactions and in the study of carbohydrate-based molecules. Additionally, it is used in research related to medicinal chemistry and drug delivery systems.

About

CAS No 138-52-3
English Name 2-(Hydroxymethyl)phenyl beta-D-glucopyranoside
Molecular Formula C13H18O7
Molecular Weight 286.28 g/mol
SMILES c1ccc(c(c1)CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O
InChIKey NGFMICBWJRZIBI-UJPOAAIJSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3)?

2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3) is a glycoside compound consisting of...

Compound Q&A

Is 2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3) safe?

2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3) is generally considered safe when han...

Compound Q&A

How should 2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3) be stored?

2-(Hydroxymethyl)phenyl beta-D-glucopyranoside (CAS: 138-52-3) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...