Compound Q&A

What is 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3)?

Answer

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one
3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3) is a flavonoid compound with the chemical formula C15H10O6. It features a chromen-4-one ring system substituted with hydroxyl groups at positions 3, 5, and 7, along with a 4-hydroxyphenyl group at position 2. This compound is known for its antioxidant properties and is commonly used in pharmaceutical and research applications due to its bioactive characteristics.

About

CAS No 520-18-3
English Name 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one
Molecular Formula C15H10O6
Molecular Weight 286.24 g/mol
SMILES Oc1ccc(cc1)c2oc3cc(O)cc(O)c3c(=O)c2O
InChIKey IYRMWMYZSQPJKC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3)?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3) is primarily used in pharmaceu...

Compound Q&A

Is 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3) safe?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3) is generally considered safe w...

Compound Q&A

How should 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3) be stored?

3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one (CAS: 520-18-3) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...