Compound Q&A

What is 3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one (CAS: 77-09-8)?

Answer

3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one
3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one, with the CAS number 77-09-8, is a synthetic organic compound characterized by a benzofuran ring substituted with two hydroxyphenyl groups. It is known for its aromatic structure and potential applications in pharmaceutical and chemical research. The compound is typically yellow to orange in color and has a molecular formula of C19H14O4.

About

CAS No 77-09-8
English Name 3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one
Molecular Formula C20H14O4
Molecular Weight 318.33 g/mol
SMILES Oc1ccc(cc1)C2(OC(=O)c3ccccc32)c4ccc(O)cc4
InChIKey KJFMBFZCATUALV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one (CAS: 77-09-8)?

3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one (CAS: 77-09-8) is primarily used in pharmaceutical r...

Compound Q&A

Is 3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one (CAS: 77-09-8) safe?

3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one (CAS: 77-09-8) is generally considered safe when han...

Compound Q&A

How should 3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one (CAS: 77-09-8) be stored?

3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one (CAS: 77-09-8) should be stored in a cool, dry, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...