Compound Q&A

What are the main uses of 1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone (CAS: 8002-74-2)?

Answer

1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone
This compound is primarily used as a pharmaceutical intermediate in the synthesis of certain drugs, including antipsychotics and antihistamines. It also serves as a key component in industrial chemical processes and research applications, particularly in the development of organic compounds with specific functional groups. Its versatility makes it valuable in medicinal chemistry and specialty chemical manufacturing.

About

CAS No 8002-74-2
English Name 1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone
Molecular Formula C21H27NO3
Molecular Weight 341.45 g/mol
EINECS 232-315-6
SMILES CCCNCC(COc1ccccc1C(=O)CCc2ccccc2)O
InChIKey JWHAUXFOSRPERK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone (CAS: 8002-74-2)?

1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone (CAS: 8002-74-2) is an organic c...

Compound Q&A

Is 1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone (CAS: 8002-74-2) safe?

The safety of 1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone (CAS: 8002-74-2) d...

Compound Q&A

How should 1-{2-[2-Hydroxy-3-(propylamino)propoxy]phenyl}-3-phenyl-1-propanone (CAS: 8002-74-2) be stored?

This compound should be stored in a cool, dry, and well-ventilated area, away from light and moistur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...