Compound Q&A

What are the main uses of N-Benzyl-N,N-diethylethanaminium chloride (CAS: 56-37-1)?

Answer

N-Benzyl-N,N-diethylethanaminium chloride
N-Benzyl-N,N-diethylethanaminium chloride (CAS: 56-37-1) is primarily used in pharmaceutical research for the synthesis of various drugs and as a chiral auxiliary. It also finds applications in organic chemistry as a reagent for catalytic processes and in the production of surfactants. Its utility extends to research in medicinal chemistry and industrial chemical manufacturing.

About

CAS No 56-37-1
English Name N-Benzyl-N,N-diethylethanaminium chloride
Molecular Formula C13H22ClN
Molecular Weight 227.77 g/mol
SMILES [Cl-].CC[N+](CC)(CC)Cc1ccccc1
InChIKey HTZCNXWZYVXIMZ-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is N-Benzyl-N,N-diethylethanaminium chloride (CAS: 56-37-1)?

N-Benzyl-N,N-diethylethanaminium chloride, with the CAS number 56-37-1, is a quaternary ammonium sal...

Compound Q&A

Is N-Benzyl-N,N-diethylethanaminium chloride (CAS: 56-37-1) safe?

N-Benzyl-N,N-diethylethanaminium chloride (CAS: 56-37-1) is generally considered safe when handled p...

Compound Q&A

How should N-Benzyl-N,N-diethylethanaminium chloride (CAS: 56-37-1) be stored?

N-Benzyl-N,N-diethylethanaminium chloride (CAS: 56-37-1) should be stored in a cool, dry place away ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...