Compound Q&A

How should 2,3-Pyridinedicarboxylic acid (CAS: 89-00-9) be stored?

Answer

2,3-Pyridinedicarboxylic acid
2,3-Pyridinedicarboxylic acid (CAS: 89-00-9) should be stored in a cool, dry, and well-ventilated place, away from light. It is typically kept in a sealed container to prevent moisture absorption. Storage conditions should maintain a temperature below 25°C and ensure low humidity to preserve its stability and purity.

About

CAS No 89-00-9
English Name 2,3-Pyridinedicarboxylic acid
Molecular Formula C7H5NO4
Molecular Weight 167.12 g/mol
SMILES C1=CC(=C(N=C1)C(=O)O)C(=O)O
InChIKey GJAWHXHKYYXBSV-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2,3-Pyridinedicarboxylic acid (CAS: 89-00-9)?

2,3-Pyridinedicarboxylic acid (CAS: 89-00-9) is a chemical compound with the molecular formula C5H4N...

Compound Q&A

What are the main uses of 2,3-Pyridinedicarboxylic acid (CAS: 89-00-9)?

2,3-Pyridinedicarboxylic acid (CAS: 89-00-9) is widely used in the pharmaceutical industry for the s...

Compound Q&A

Is 2,3-Pyridinedicarboxylic acid (CAS: 89-00-9) safe?

2,3-Pyridinedicarboxylic acid (CAS: 89-00-9) is generally considered safe when handled properly. How...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...