Compound Q&A

What is 4'-[(1,7'-Dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl]-2-biphenylcarboxylic acid (CAS: 144701-48-4)?

Answer

4'-[(1,7'-Dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl]-2-biphenylcarboxylic acid
It is a complex organic compound with a molecular structure that includes a biphenylcarboxylic acid core and a substituted bibenzimidazole group. The compound is known for its potential applications in pharmaceutical and materials science due to its unique chemical properties and molecular complexity.

About

English Name 4'-[(1,7'-Dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazol-3'-yl)methyl]-2-biphenylcarboxylic acid
Molecular Formula C33H30N4O2
Molecular Weight 514.63 g/mol
SMILES CCCc1nc2c(C)cc(cc2n1Cc3ccc(cc3)c4ccccc4C(=O)O)c5nc6ccccc6n5C
InChIKey RMMXLENWKUUMAY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 4'-[(1,7'-Dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazole-3'-yl)methyl]-2-biphenylcarboxylic acid (CAS: 144701-48-4)?

This compound is primarily used in pharmaceutical research for its potential as a ligand or scaffold...

Compound Q&A

Is 4'-[(1,7'-Dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazole-3'-yl)methyl]-2-biphenylcarboxylic acid (CAS: 144701-48-4) safe?

Safety data for this specific compound is limited, but as with many complex organic compounds, it sh...

Compound Q&A

How should 4'-[(1,7'-Dimethyl-2'-propyl-1H,3'H-2,5'-bibenzimidazole-3'-yl)methyl]-2-biphenylcarboxylic acid (CAS: 144701-48-4) be stored?

The compound should be stored in a cool, dry, and well-ventilated area, away from light and moisture...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...