Compound Q&A

What is Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6)?

Answer

Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate
Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6) is an organic compound used primarily in pharmaceutical applications. It has a molecular formula of C14H11Cl2NO4Na and is known for its white to light yellow appearance. This compound is soluble in water and is commonly used as an intermediate in drug synthesis. Its structure includes a sodium ion, an acetate group, and a substituted phenyl ring, making it relevant in the development of various medicinal products.

About

CAS No 15307-79-6
English Name Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate
Molecular Formula C14H10Cl2NNaO2
Molecular Weight 318.1 g/mol
SMILES C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[Na+]
InChIKey KPHWPUGNDIVLNH-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6)?

Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6) is primarily used in pharmaceu...

Compound Q&A

Is Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6) safe?

Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6) is generally considered safe w...

Compound Q&A

How should Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6) be stored?

Sodium {2-[(2,6-dichlorophenyl)amino]phenyl}acetate (CAS: 15307-79-6) should be stored in a cool, dr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...