Compound Q&A

What is Tyrosine (CAS: 60-18-4)?

Answer

Tyrosine
Tyrosine is an amino acid with the chemical formula C9H11NO3. It is a naturally occurring compound in the human body and is essential for the synthesis of proteins, neurotransmitters, and hormones. Tyrosine is also found in many foods, such as dairy, meat, and fish. As a precursor to dopamine, norepinephrine, and thyroid hormones, it plays a crucial role in brain function and metabolism. Its CAS number is 60-18-4, which helps in identifying and regulating its use in scientific and industrial contexts.

About

CAS No 60-18-4
English Name Tyrosine
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES N[C@@H](Cc1ccc(O)cc1)C(=O)O
InChIKey OUYCCCASQSFEME-QMMMGPOBSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Tyrosine (CAS: 60-18-4)?

Tyrosine is widely used in pharmaceuticals as a precursor for drugs like levodopa. In the food indus...

Compound Q&A

Is Tyrosine (CAS: 60-18-4) safe?

Tyrosine is generally considered safe when consumed in appropriate amounts. It is a naturally occurr...

Compound Q&A

How should Tyrosine (CAS: 60-18-4) be stored?

Tyrosine should be stored in a cool, dry, and dark place to maintain its stability and prevent degra...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...