Compound Q&A

What is (2R,3R)-2,3-Dihydroxysuccinic acid (CAS: 87-69-4)?

Answer

(2R,3R)-2,3-Dihydroxysuccinic acid
(2R,3R)-2,3-Dihydroxysuccinic acid, also known as L-tartaric acid, is a naturally occurring organic compound with the chemical formula C4H6O6. It is a white crystalline solid with a sour taste and high water solubility. This compound is chiral, with both stereocenters in the R configuration. L-tartaric acid is widely used in various industries due to its unique chemical properties and ability to form stable complexes with metal ions.

About

CAS No 87-69-4
English Name (2R,3R)-2,3-Dihydroxysuccinic acid
Molecular Formula C4H6O6
Molecular Weight 150.09 g/mol
SMILES O[C@H]([C@@H](O)C(=O)O)C(=O)O
InChIKey FEWJPZIEWOKRBE-JCYAYHJZSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (2R,3R)-2,3-Dihydroxysuccinic acid (CAS: 87-69-4)?

(2R,3R)-2,3-Dihydroxysuccinic acid (L-tartaric acid) is commonly used in the pharmaceutical industry...

Compound Q&A

Is (2R,3R)-2,3-Dihydroxysuccinic acid (CAS: 87-69-4) safe?

(2R,3R)-2,3-Dihydroxysuccinic acid (L-tartaric acid) is generally considered safe when used in appro...

Compound Q&A

How should (2R,3R)-2,3-Dihydroxysuccinic acid (CAS: 87-69-4) be stored?

(2R,3R)-2,3-Dihydroxysuccinic acid should be stored in a cool, dry place away from moisture and ligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...