Compound Q&A

What is Metaphosphoric acid (H6P6O18), sodium salt (1:6) (CAS: 10124-56-8)?

Answer

Metaphosphoric acid (H6P6O18), sodium salt (1:6)
Metaphosphoric acid (H6P6O18), sodium salt (1:6) is a sodium salt of metaphosphoric acid, with the chemical formula Na6P6O18. It is a white, water-soluble powder commonly used in various industrial applications. This compound is known for its strong acidic properties and ability to chelate metal ions. It is often used as a stabilizer and pH adjuster in chemical processes and formulations.

About

CAS No 10124-56-8
English Name Metaphosphoric acid (H6P6O18), sodium salt (1:6)
Molecular Formula H6NaO18P6
Molecular Weight 502.86 g/mol
SMILES OP1(=O)OP(=O)(O)OP(=O)(O)OP(=O)(OP(=O)(OP(=O)(O1)O)O)O.[Na]
InChIKey FVFHXLBTPAOQHD-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Metaphosphoric acid (H6P6O18), sodium salt (1:6) (CAS: 10124-56-8)?

Metaphosphoric acid (H6P6O18), sodium salt (1:6) is widely used in the food industry as a sequestran...

Compound Q&A

Is Metaphosphoric acid (H6P6O18), sodium salt (1:6) (CAS: 10124-56-8) safe?

Metaphosphoric acid (H6P6O18), sodium salt (1:6) is generally considered safe when handled properly....

Compound Q&A

How should Metaphosphoric acid (H6P6O18), sodium salt (1:6) (CAS: 10124-56-8) be stored?

Metaphosphoric acid (H6P6O18), sodium salt (1:6) should be stored in a cool, dry place away from dir...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...