(4R,9beta,16alpha,24S)-2,25-Dihydroxy-9,10,14-trimethyl-16,24-epoxy-4,9-cyclo-9,10-secocholesta-2,5-diene-1,11,22-trione(CAS: 60137-06-6)

CAS Number
Related Products
Other Suppliers for (4R,9beta,16alpha,24S)-2,25-Dihydroxy-9,10,14-trimethyl-16,24-epoxy-4,9-cyclo-9,10-secocholesta-2,5-diene-1,11,22-trione
Basic Information
Molecular Formula
C30H42O6
Molecular Weight
498.66 g/mol
Physical State
Powder
Physical Properties
Density
1.22±0.1 g/cm3 (20 ºC 760 Torr),
Chemical Identifiers
SMILES
C[C@H]1[C@H]2[C@@H](C[C@@]3([C@@]2(CC(=O)[C@@]4([C@H]3CC=C5[C@H]4C=C(C(=O)C5(C)C)O)C)C)C)O[C@@H](CC1=O)C(C)(C)O
InChIKey
MBYLRWSUZLFUTO-PQNVQGKDSA-N
Database References
MDL Number
MFCD13193204
FAQ
(4R,9beta,16alpha,24S)-2,25-Dihydroxy-9,10,14-trimethyl-16,24-epoxy-4,9-cyclo-9,10-secocholesta-2,5-diene-1,11,22-trione is a complex organic compound with a unique molecular structure. The CAS number 60137-06-6 identifies this compound, which is a derivative of cholesterol. It is characterized by its dihydroxy, epoxy, and cyclo structures, making it a specialized chemical for various applications.
(4R,9beta,16alpha,24S)-2,25-Dihydroxy-9,10,14-trimethyl-16,24-epoxy-4,9-cyclo-9,10-secocholesta-2,5-diene-1,11,22-trione (CAS: 60137-06-6) is primarily used in pharmaceuticals for its potential in drug development. It also finds applications in research and development for its unique chemical properties, though its commercial applications are more limited due to its complexity and specificity.
(4R,9beta,16alpha,24S)-2,25-Dihydroxy-9,10,14-trimethyl-16,24-epoxy-4,9-cyclo-9,10-secocholesta-2,5-diene-1,11,22-trione (CAS: 60137-06-6) is generally considered safe under controlled laboratory conditions and with proper handling. However, as with any chemical, it requires appropriate safety measures, such as wearing protective gear and ensuring proper ventilation. Users should follow safety guidelines provided by the manufacturer and regulatory authorities.
(4R,9beta,16alpha,24S)-2,25-Dihydroxy-9,10,14-trimethyl-16,24-epoxy-4,9-cyclo-9,10-secocholesta-2,5-diene-1,11,22-trione (CAS: 60137-06-6) should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to store it in a sealed container to prevent degradation. Proper labeling and maintaining a controlled environment are crucial to ensure its stability and safety during storage and use.
Safety Notice
Please verify product specifications and safety data before use. Contact the supplier for detailed safety information.
Always follow proper handling procedures

![(6aS)-2,10-Dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol](https://static.chemtradehub.com/structs/235/23599-69-1-76de.webp)













