Compound Q&A

What industries use L-Cysteinyl-L-cysteine (CAS: 18048-87-8)?

Answer

L-Cysteinyl-L-cysteine
L-Cysteinyl-L-cysteine (CAS: 18048-87-8) finds applications in various industries including pharmaceuticals, where it acts as a precursor for the synthesis of peptides and proteins; in polymer chemistry for the modification of polymers; in sensor technology, where it is used for detecting reducing sugars; and in the semiconductor industry, where it is employed in the fabrication of certain electronic components.

About

CAS No 18048-87-8
English Name L-Cysteinyl-L-cysteine
Molecular Formula C6H12N2O3S2
Molecular Weight 224.30700000000002 g/mol
SMILES C(C(C(=O)NC(CS)C(=O)O)N)S
InChIKey OABOXRPGTFRBFZ-IMJSIDKUSA-N
Last Updated: 2026-04-01 14:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of L-Cysteinyl-L-cysteine (CAS: 18048-87-8)?

L-Cysteinyl-L-cysteine (CAS: 18048-87-8) is a white crystalline powder with a molecular weight of ap...

Compound Q&A

How is L-Cysteinyl-L-cysteine (CAS: 18048-87-8) typically synthesized?

L-Cysteinyl-L-cysteine (CAS: 18048-87-8) is synthesized through a condensation reaction of L-cystein...

Compound Q&A

What precautions should be taken when handling L-Cysteinyl-L-cysteine (CAS: 18048-87-8)?

When handling L-Cysteinyl-L-cysteine (CAS: 18048-87-8), proper personal protective equipment (PPE) s...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...