Compound Q&A

What are the physical and chemical properties of 3'-Sialyl Lewis A (CAS: 92448-22-1)?

Answer

3'-Sialyl Lewis A
3'-Sialyl Lewis A is a glycan with a molecular weight of approximately 440 Da. It is poorly soluble in water but soluble in organic solvents like methanol and ethanol. This compound is known for its reactivity towards reducing agents, making it suitable for various bioconjugation applications. Its crystalline form has a melting point around 180°C.

About

CAS No 92448-22-1
English Name 3'-Sialyl Lewis A
Molecular Formula C31H52N2O23
Molecular Weight 820.7 g/mol
SMILES CC1C(C(C(C(O1)OC(C(CO)O)C(C(C=O)NC(=O)C)OC2C(C(C(C(O2)CO)O)OC3(CC(C(C(O3)C(C(CO)O)O)NC(=O)C)O)C(=O)O)O)O)O)O
InChIKey INZOTETZQBPBCE-NYLDSJSYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is 3'-Sialyl Lewis A (CAS: 92448-22-1) typically synthesized?

3'-Sialyl Lewis A is synthesized through chemical modifications of the Lewis A structure. The synthe...

Compound Q&A

What industries use 3'-Sialyl Lewis A (CAS: 92448-22-1)?

3'-Sialyl Lewis A is widely used in the pharmaceutical industry for drug development, particularly i...

Compound Q&A

What precautions should be taken when handling 3'-Sialyl Lewis A (CAS: 92448-22-1)?

When handling 3'-Sialyl Lewis A, it is essential to wear appropriate personal protective equipment (...

Compound Q&A

What regulatory guidelines apply to 4-Amino-3-bromophenol (CAS: 74440-80-5)?

4-Amino-3-bromophenol (CAS: 74440-80-5) falls under the classification of a haza...

74440-80-54-Amino-3-bromopheno...
Compound Q&A

How should (17beta)-3-Oxoestr-4-en-17-yl acetate (CAS: 1425-10-1) be stored?

(17beta)-3-Oxoestr-4-en-17-yl acetate should be stored in a cool, dry place away...

1425-10-1(17beta)-3-Oxoestr-4...
Compound Q&A

What are the physical and chemical properties of 2-[(2,2-Diethoxyethyl)disulfanyl]-1,1-diethoxyethane (CAS: 76505-71-0)?

2-[(2,2-Diethoxyethyl)disulfanyl]-1,1-diethoxyethane (CAS: 76505-71-0) is a colo...

76505-71-02-[(2,2-Diethoxyethy...
Compound Q&A

What is the market or research trend for 1-(β-D-ribofuranosyl)-1H-imidazo[4,5-c]pyridin-4-amine?

The market and research for 1-(β-D-ribofuranosyl)-1H-imidazo[4,5-c]pyridin-4-ami...

6736-58-91-(beta-D-Ribofurano...