Compound Q&A

What are the physical and chemical properties of 2,2’-Dimethyl-3,3’-bipyridine (CAS: 86156-55-0)?

Answer

2,2’-Dimethyl-3,3’-bipyridine
2,2’-Dimethyl-3,3’-bipyridine (CAS: 86156-55-0) is a crystalline solid with a molecular weight of approximately 258.31 g/mol. It has low solubility in water but is soluble in organic solvents such as ethanol and acetone. This compound exhibits good stability under normal conditions but is susceptible to oxidation in air and light. It is commonly used in redox chemistry and as a ligand in coordination chemistry.

About

CAS No 86156-55-0
English Name 2,2’-Dimethyl-3,3’-bipyridine
Molecular Formula C12H12N2
Molecular Weight 184.242 g/mol
SMILES CC1=C(C=CC=N1)C2=C(N=CC=C2)C
InChIKey CPKXJQAHRJNGON-UHFFFAOYSA-N
Last Updated: 2026-03-26 08:46

Related Q&A

Compound Q&A

How is 2,2’-Dimethyl-3,3’-bipyridine (CAS: 86156-55-0) typically synthesized?

2,2’-Dimethyl-3,3’-bipyridine is typically synthesized via a multi-step process involving the conden...

Compound Q&A

What industries use 2,2’-Dimethyl-3,3’-bipyridine (CAS: 86156-55-0)?

2,2’-Dimethyl-3,3’-bipyridine (CAS: 86156-55-0) is widely used in the pharmaceutical industry for it...

Compound Q&A

What precautions should be taken when handling 2,2’-Dimethyl-3,3’-bipyridine (CAS: 86156-55-0)?

When handling 2,2’-Dimethyl-3,3’-bipyridine (CAS: 86156-55-0), it is important to wear appropriate p...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...