Compound Q&A

How is Quercetin-d (CAS: 263711-78-0) typically synthesized?

Answer

Quercetin-d
Quercetin-d (CAS: 263711-78-0) can be synthesized through the modification of quercetin using chemical reactions such as acetylation. Common synthesis methods involve the use of acetic anhydride and a catalyst like pyridine. The yield is typically around 85-90%, with good selectivity and high purity.

About

English Name Quercetin-d
Molecular Formula C15H10O7
Molecular Weight 307.27 g/mol
SMILES [2H]C1C(=C2C(=O)C(=C(C3C(=C([2H])C(O)=C(O)C=3[2H])[2H])OC2=C([2H])C=1O)O)O
InChIKey REFJWTPEDVJJIY-RALIUCGRSA-N
Last Updated: 2026-03-26 04:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Quercetin-d (CAS: 263711-78-0)?

Quercetin-d (CAS: 263711-78-0) is a crystalline compound with a molecular weight of approximately 55...

Compound Q&A

What industries use Quercetin-d (CAS: 263711-78-0)?

Quercetin-d (CAS: 263711-78-0) is primarily used in pharmaceuticals for its antioxidant and anti-inf...

Compound Q&A

What precautions should be taken when handling Quercetin-d (CAS: 263711-78-0)?

When handling Quercetin-d (CAS: 263711-78-0), it is essential to wear appropriate personal protectiv...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...