Compound Q&A

What are the main uses of Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5)?

Answer

Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate
Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5) is primarily used as a research chemical in the pharmaceutical industry. It serves as a precursor for the synthesis of novel drug candidates, particularly in the field of anti-inflammatory and analgesic drug development. Additionally, it is utilized in the research of various biological pathways and therapeutic targets.

About

English Name Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate
Molecular Formula C12H18N2O2
Molecular Weight 222.28799999999993 g/mol
SMILES CCOC(=O)c1c2c([nH]n1)CC(CC2)(C)C
InChIKey JTFYBRYMPBDWKO-UHFFFAOYSA-N
Last Updated: 2026-03-22 03:59

Related Q&A

Compound Q&A

What is Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5)?

Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5) is a synthetic c...

Compound Q&A

Is Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5) safe?

Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5) is generally con...

Compound Q&A

How should Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5) be stored?

Ethyl 6,6-dimethyl-4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS: 1233243-56-5) should be stored...

Compound Q&A

What is Ethyl 3-cyclohexylpropanoate (CAS: 10094-36-7)?

Ethyl 3-cyclohexylpropanoate is a clear, colorless to light yellow liquid with a...

10094-36-7Ethyl 3-cyclohexylpr...
Compound Q&A

How should waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl)nicotinic acid (CAS: 34783-31-8) be handled?

Waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl...

34783-31-82-(Hydroxymethyl)-5-...
Compound Q&A

How should waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) be handled?

Waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) sho...

858-46-82,4,6-Tris(pentafluo...
Compound Q&A

What precautions should be taken when handling Chloroac-nle-oh (CAS: 56787-36-1)?

When handling Chloroac-nle-oh (CAS: 56787-36-1), it is essential to wear appropr...

56787-36-1Chloroac-nle-oh