Compound Q&A

Are there alternatives to Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6) in synthesis?

Answer

Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate
There are alternative compounds that can be used in synthesis as substitutes for Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6). For instance, other aryl glycosides or similar benzyl derivatives can serve as viable alternatives depending on the specific reaction conditions and desired properties. Common reagents such as benzyl alcohol and glucose derivatives can be explored as potential substitutes.

About

English Name Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate
Molecular Formula C20H22O9
Molecular Weight 406.38700000000006 g/mol
SMILES OC[C@H]1O[C@@H](OC2=C(C(=O)OCC3=CC=CC=C3)C(O)=CC=C2)[C@H](O)[C@@H](O)[C@@H]1O
InChIKey GTFARABJCNHOHO-UVNCQSPWSA-N
Last Updated: 2026-03-20 21:11

Related Q&A

Compound Q&A

What regulatory guidelines apply to Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6)?

Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6) falls under chemical regula...

Compound Q&A

What is the market or research trend for Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6)?

The market for Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6) is currently...

Compound Q&A

How should waste containing Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6) be handled?

Waste containing Benzyl 2-(beta-D-glucopyranosyloxy)-6-hydroxybenzoate (CAS: 403857-21-6) should be ...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...