Compound Q&A

What are the main uses of 3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile (CAS: 798574-82-0)?

Answer

3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile
3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile is mainly used as an intermediate in the synthesis of pharmaceuticals. It plays a crucial role in the development of new drugs, particularly in the treatment of various diseases. Additionally, it is sometimes utilized in research for its unique chemical properties.

About

English Name 3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile
Molecular Formula C8H2BrClN2S
Molecular Weight 273.54 g/mol
SMILES C1=C(C(=C2C(=N1)C(=CS2)Br)Cl)C#N
InChIKey FUKLHGNGWZUKFH-UHFFFAOYSA-N
Last Updated: 2026-03-16 04:59

Related Q&A

Compound Q&A

What is 3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile (CAS: 798574-82-0)?

3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile is an organic compound with the molecular formu...

Compound Q&A

Is 3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile (CAS: 798574-82-0) safe?

3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile can be safe if handled properly. It is importan...

Compound Q&A

How should 3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile (CAS: 798574-82-0) be stored?

3-Bromo-7-chlorothieno[3,2-b]pyridine-6-carbonitrile should be stored in a cool, dry place away from...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...