Compound Q&A

What are the physical and chemical properties of 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

Answer

8-Fluoroquinolin-6-ol
8-Fluoroquinolin-6-ol (CAS: 209353-22-0) is a compound with a molecular weight of approximately 165.07 g/mol. It crystallizes in a monoclinic form and has a solubility of about 10 mg/mL in water. The compound is relatively stable but can undergo dehydrogenation under strongly acidic conditions. It is commonly used as a starting material in the synthesis of various pharmaceuticals and organic compounds.

About

English Name 8-Fluoroquinolin-6-ol
Molecular Formula C9H6FNO
Molecular Weight 163.15099999999998 g/mol
SMILES C1=CC2=CC(=CC(=C2N=C1)F)O
InChIKey ATQMMXTUQMSGLY-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 8-Fluoroquinolin-6-ol (CAS: 209353-22-0) typically synthesized?

8-Fluoroquinolin-6-ol (CAS: 209353-22-0) can be synthesized via a multi-step process starting from 6...

Compound Q&A

What industries use 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

8-Fluoroquinolin-6-ol (CAS: 209353-22-0) is primarily used in the pharmaceutical and chemical indust...

Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use proper personal prote...

Compound Q&A

What are the main uses of (5-Sulfamoyl-3-pyridinyl)boronic acid (CAS: 951233-61-7)?

(5-Sulfamoyl-3-pyridinyl)boronic acid is primarily used in chemical synthesis, p...

951233-61-7(5-Sulfamoyl-3-pyrid...
Compound Q&A

How is Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate (CAS: 1942858-50-5) typically synthesized?

Benzyl 2-methyl-2-(methylsulfonyl)-4-pentenoate is typically synthesized via est...

1942858-50-5Benzyl 2-methyl-2-(m...
Compound Q&A

What precautions should be taken when handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0)?

When handling 8-Fluoroquinolin-6-ol (CAS: 209353-22-0), it is important to use p...

209353-22-08-Fluoroquinolin-6-o...
Compound Q&A

What are the physical and chemical properties of 1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2)?

1,3-Dibromo-5-(2-methyl-2-propanyl)benzene (CAS: 129316-09-2) is a crystalline c...

129316-09-21,3-Dibromo-5-(2-met...