Compound Q&A

What industries use Apigenin-d5 (CAS: 263711-74-6)?

Answer

Apigenin-d5
Apigenin-d5 is primarily used in the pharmaceutical and research industries. It serves as a labeled standard in bioassays and biomarker detection. Additionally, it is applied in analytical chemistry for the development of sensitive detection methods. Its deuterated nature makes it useful in NMR spectroscopy and mass spectrometry for compound identification and characterization.

About

English Name Apigenin-d5
Molecular Formula C15H5D5O5
Molecular Weight 275.27050889 g/mol
SMILES [2H]c1cc(cc(c1O)[2H])c2c(c(=O)c3c(c(c(c(c3o2)[2H])O)[2H])O)[2H]
InChIKey KZNIFHPLKGYRTM-DKFMXDSJSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Apigenin-d5 (CAS: 263711-74-6)?

Apigenin-d5 is a di-deuterated derivative of apigenin. It crystallizes in the monoclinic system. The...

Compound Q&A

How is Apigenin-d5 (CAS: 263711-74-6) typically synthesized?

Apigenin-d5 is synthesized by various methods, but one common approach involves the bromination of a...

Compound Q&A

What precautions should be taken when handling Apigenin-d5 (CAS: 263711-74-6)?

When handling Apigenin-d5, it is recommended to use proper personal protective equipment (PPE) such ...

Compound Q&A

Is Sodium Acrylate (CAS: 7446-81-3) safe?

Sodium acrylate (CAS: 7446-81-3) is generally recognized as safe (GRAS) by the F...

7446-81-3Sodium acrylate
Compound Q&A

What are the physical and chemical properties of Boc-N-PEG2-Ms (CAS: 302331-20-0)?

Boc-N-PEG2-Ms is a bifunctional polyethylene glycol derivative with a molecular ...

302331-20-0Boc-N-PEG2-Ms
Compound Q&A

What regulatory guidelines apply to 2-[3-(4-Methylbenzoyl)phenyl]propanoic acid (CAS: 107257-20-5)?

2-[3-(4-Methylbenzoyl)phenyl]propanoic acid (CAS: 107257-20-5) should comply wit...

107257-20-52-[3-(4-Methylbenzoy...
Compound Q&A

How should 1H-Pyrazolo[3,4-b]pyridine-3-carbaldehyde (CAS: 1010073-87-6) be stored?

1H-Pyrazolo[3,4-b]pyridine-3-carbaldehyde should be stored in a cool, dry place ...

1010073-87-61H-Pyrazolo[3,4-b]py...