Compound Q&A

How is Triethoxy(octyl)silane (CAS: 1385031-14-0) typically synthesized?

Answer

Triethoxy(octyl)silane
Triethoxy(octyl)silane is synthesized through a reaction between octyl chloride and triethoxy silane. The reaction is typically catalyzed by a strong base such as sodium hydride. The process involves the displacement of the chlorine atom in octyl chloride by the ethoxy group from the triethoxy silane, resulting in high selectivity and yield.

About

English Name Triethoxy(octyl)silane
Molecular Formula C14H32O3Si
Molecular Weight 276.493 g/mol
SMILES CCCCCCCC[Si](OCC)(OCC)OCC
InChIKey MSRJTTSHWYDFIU-UHFFFAOYSA-N
Last Updated: 2026-03-08 09:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triethoxy(octyl)silane (CAS: 1385031-14-0)?

Triethoxy(octyl)silane (CAS: 1385031-14-0) is a colorless to slightly yellow liquid with a relativel...

Compound Q&A

What industries use Triethoxy(octyl)silane (CAS: 1385031-14-0)?

Triethoxy(octyl)silane (CAS: 1385031-14-0) is widely used in the pharmaceuticals, polymer manufactur...

Compound Q&A

What precautions should be taken when handling Triethoxy(octyl)silane (CAS: 1385031-14-0)?

Triethoxy(octyl)silane should be handled with appropriate personal protective equipment (PPE) includ...

Compound Q&A

How should waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) be handled?

Waste containing 2-Ethyl-4-Methyl-1H-Imidazole-5-Carbaldehyde (CAS: 88634-80-4) ...

88634-80-42-Ethyl-4-Methyl-1H-...
Compound Q&A

What industries use Triethoxy(octyl)silane (CAS: 1385031-14-0)?

Triethoxy(octyl)silane (CAS: 1385031-14-0) is widely used in the pharmaceuticals...

1385031-14-0Triethoxy(octyl)sila...
Compound Q&A

Are there alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) in synthesis?

Several alternatives to 3-iodo-7-nitro-1H-indazole (CAS: 864724-64-1) exist in t...

864724-64-13-iodo-7-nitro-1H-in...
Compound Q&A

Are there alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317-71-9) in synthesis?

Yes, there are alternatives to Benzene, bis[(trimethoxysilyl)ethyl] (CAS: 266317...

266317-71-9Benzene, bis[(trimet...