Compound Q&A

What is 6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride (CAS: 6461-30-9)?

Answer

6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride
6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride is a chemical compound with the CAS number 6461-30-9. It is an intermediate used in the synthesis of various pharmaceuticals and research compounds. This compound is characterized by its specific functional groups and molecular structure, making it suitable for specific chemical reactions.

About

CAS No 6461-30-9
English Name 6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride
Molecular Formula C5H5ClN2O4S
Molecular Weight 224.62499999999997 g/mol
SMILES Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)Cl
InChIKey XDXYTKIQVSJRIX-UHFFFAOYSA-N
Last Updated: 2026-03-06 16:21

Related Q&A

Compound Q&A

What are the main uses of 6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride (CAS: 6461-30-9)?

6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride is primarily used as an intermed...

Compound Q&A

Is 6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride (CAS: 6461-30-9) safe?

6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride is generally considered safe whe...

Compound Q&A

How should 6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride (CAS: 6461-30-9) be stored?

6-Methyl-2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinesulfonyl chloride should be stored in a cool, dry,...

Compound Q&A

Is 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) safe?

The safety of 1-[(4-Bromophenyl)sulfonyl]azetidine (CAS: 530081-57-3) depends on...

530081-57-31-[(4-Bromophenyl)su...
Compound Q&A

What are the physical and chemical properties of 1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2)?

1-N,3-N-diphenylbenzene-1,3-diamine (CAS: 5905-36-2) is a solid with a crystalli...

5905-36-21-N,3-N-diphenylbenz...
Compound Q&A

Is 2-Methyl-2-nitropropane (CAS: 594-70-7) safe?

2-Methyl-2-nitropropane is generally safe when handled with appropriate precauti...

594-70-72-Methyl-2-nitroprop...
Compound Q&A

How should waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) be handled?

Waste containing 1-(2,3-Difluoro-6-methoxyphenyl)methanamine (CAS: 886501-77-5) ...

886501-77-51-(2,3-Difluoro-6-me...