Compound Q&A

What are the physical and chemical properties of 2-Methylchrysene (CAS: 3351-32-4)?

Answer

2-Methylchrysene
2-Methylchrysene (CAS: 3351-32-4) is a polycyclic aromatic hydrocarbon. It exists in a crystalline form with a molecular weight of approximately 246.26 g/mol. Its solubility in common solvents such as ethanol and water is low. Chemically, it is relatively stable but can undergo reactions such as oxidation and substitution under certain conditions.

About

CAS No 3351-32-4
English Name 2-Methylchrysene
Molecular Formula C19H14
Molecular Weight 242.321 g/mol
SMILES CC1=CC2=C(C=C1)C3=C(C=C2)C4=CC=CC=C4C=C3
InChIKey PJVVBVYEMMJZCY-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

How is 2-Methylchrysene (CAS: 3351-32-4) typically synthesized?

2-Methylchrysene (CAS: 3351-32-4) is typically synthesized via the reaction of chrysene with methyl ...

Compound Q&A

What industries use 2-Methylchrysene (CAS: 3351-32-4)?

2-Methylchrysene (CAS: 3351-32-4) is primarily used in the pharmaceutical, polymer, and semiconducto...

Compound Q&A

What precautions should be taken when handling 2-Methylchrysene (CAS: 3351-32-4)?

When handling 2-Methylchrysene (CAS: 3351-32-4), it is essential to use personal protective equipmen...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 5-amino-2-thiophenecarboxylate (CAS: 1498311-57-1)?

When handling 2-Methyl-2-propanyl 5-amino-2-thiophenecarboxylate (CAS: 1498311-5...

1498311-57-12-Methyl-2-propanyl ...
Compound Q&A

What are the physical and chemical properties of 5-Bromo-1,2-dichloro-3-fluorobenzene (CAS: 1000572-93-9)?

5-Bromo-1,2-dichloro-3-fluorobenzene (CAS: 1000572-93-9) is a crystalline solid ...

1000572-93-95-Bromo-1,2-dichloro...
Compound Q&A

How should (2R)-2-Amino-2-(4-bromophenyl)ethanol (CAS: 354153-64-3) be stored?

(2R)-2-Amino-2-(4-bromophenyl)ethanol (CAS: 354153-64-3) should be stored in a c...

354153-64-3(2R)-2-Amino-2-(4-br...
Compound Q&A

What regulatory guidelines apply to Methyl 4-(aminomethyl)tetrahydro-2H-pyran-4-carboxylate hydrochloride (CAS: 362707-24-2)?

Methyl 4-(aminomethyl)tetrahydro-2H-pyran-4-carboxylate hydrochloride (CAS: 3627...

362707-24-2Methyl 4-(aminomethy...