Compound Q&A

What industries use 6-Methoxy-2-quinolinecarboxylic acid (CAS: 75433-99-7)?

Answer

6-Methoxy-2-quinolinecarboxylic acid
6-Methoxy-2-quinolinecarboxylic acid is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drug candidates. It also finds applications in the production of certain organic pigments and dyes. Additionally, it is used in the development of sensor materials and in some electronic applications due to its structural properties.

About

CAS No 75433-99-7
English Name 6-Methoxy-2-quinolinecarboxylic acid
Molecular Formula C11H9NO3
Molecular Weight 203.197 g/mol
SMILES COC1=CC2=C(C=C1)N=C(C=C2)C(=O)O
InChIKey YXPYIZUQEDQMPS-UHFFFAOYSA-N
Last Updated: 2026-03-01 17:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methoxy-2-quinolinecarboxylic acid (CAS: 75433-99-7)?

6-Methoxy-2-quinolinecarboxylic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 6-Methoxy-2-quinolinecarboxylic acid (CAS: 75433-99-7) typically synthesized?

6-Methoxy-2-quinolinecarboxylic acid is typically synthesized through a condensation reaction betwee...

Compound Q&A

What precautions should be taken when handling 6-Methoxy-2-quinolinecarboxylic acid (CAS: 75433-99-7)?

When handling 6-Methoxy-2-quinolinecarboxylic acid, it is important to wear appropriate personal pro...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...