Compound Q&A

What is 24-Deacetylalisol O (CAS: 1067510-31-9)?

Answer

24-Deacetylalisol O (CAS: 1067510-31-9) is a natural compound derived from the plant species *Alisol*. It has a complex molecular structure and is primarily characterized by its anti-inflammatory and antioxidant properties.

About

CAS No 1067510-31-9

English Name 24-Deacetylalisol O

Molecular Formula C30H46O4

Molecular Weight 470.6838 g/mol

SMILES CC1CC(OC2C1=C3C=CC4C5(CCC(=O)C(C5CCC4(C3(C2)C)C)(C)C)C)C(C(C)(C)O)O

InChIKey ZQFQEWOYCZTQFY-UHFFFAOYSA-N

Last Updated: 2026-01-09 14:49

Related Q&A

Compound Q&A

What are the main uses of 24-Deacetylalisol O (CAS: 1067510-31-9)?

24-Deacetylalisol O (CAS: 1067510-31-9) is used in the pharmaceutical industry for its anti-inflamma...

Compound Q&A

Is 24-Deacetylalisol O (CAS: 1067510-31-9) safe?

24-Deacetylalisol O (CAS: 1067510-31-9) is considered safe when used as directed. Users should follo...

Compound Q&A

How should 24-Deacetylalisol O (CAS: 1067510-31-9) be stored?

24-Deacetylalisol O (CAS: 1067510-31-9) should be stored in a cool, dry place away from direct sunli...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is 24-Deacetylalisol O (CAS: 1067510-31-9)?

Answer

About

Related Q&A

What are the main uses of 24-Deacetylalisol O (CAS: 1067510-31-9)?

Is 24-Deacetylalisol O (CAS: 1067510-31-9) safe?

How should 24-Deacetylalisol O (CAS: 1067510-31-9) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Chengdu LeMeiTian Medical Technology Co., Ltd.

ShangHaiJiZhiShengHua Technology Co Ltd

Shanghai Hansi Chemical Co., Ltd.

SiChuanWeiKeJi Biotechnology Co Ltd

HePeng （ ShangHai ） Biotechnology Co Ltd

Shanghai Yuyeh Biotechnology Co., Ltd.