Compound Q&A

What industries use Caraphenol A (CAS: 354553-35-8)?

Answer

Caraphenol A
Caraphenol A (CAS: 354553-35-8) is used in various industries, particularly in pharmaceuticals for its potential as a bioactive compound. It also finds applications in the production of certain polymers, sensors, and semiconductors due to its unique chemical properties.

About

English Name Caraphenol A
Molecular Formula C42H28O9
Molecular Weight 676.6663 g/mol
SMILES Oc1ccc(cc1)C1Oc2c3C1c1cc(O)cc4c1C(C(O4)c1ccc(cc1)O)c1c4c(c3cc(c2)O)c(oc4cc(c1)O)c1ccc(cc1)O
InChIKey ULEJGXIKBFHUOY-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of Caraphenol A (CAS: 354553-35-8)?

Caraphenol A (CAS: 354553-35-8) is a crystalline compound with a molecular weight of approximately 2...

Compound Q&A

How is Caraphenol A (CAS: 354553-35-8) typically synthesized?

Caraphenol A (CAS: 354553-35-8) is typically synthesized via a multi-step process involving condensa...

Compound Q&A

What precautions should be taken when handling Caraphenol A (CAS: 354553-35-8)?

When handling Caraphenol A (CAS: 354553-35-8), it is crucial to wear appropriate personal protective...

Compound Q&A

What are the main uses of Methyl cellulose (CAS: 9004-67-5)?

Methyl cellulose is widely used in pharmaceuticals as a binder and disintegrant ...

9004-67-5Methyl cellulose
Compound Q&A

How is Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride (CAS: 1170782-90-7) typically synthesized?

Methyl 1-(aminomethyl)cyclopropanecarboxylate hydrochloride is typically synthes...

1170782-90-7Methyl 1-(aminomethy...
Compound Q&A

How should Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate (CAS: 371945-06-1) be stored?

Ethyl 3-aminofuro[2,3-b]pyridine-2-carboxylate should be stored in a cool, dry p...

371945-06-1Ethyl 3-aminofuro[2,...
Compound Q&A

What are the main uses of (2,4-Difluoro-3-isopropoxyphenyl)boronic acid (CAS: 1451390-95-6)?

(2,4-Difluoro-3-isopropoxyphenyl)boronic acid is primarily used in organic synth...

1451390-95-6(2,4-Difluoro-3-isop...