Compound Q&A

What are the main uses of 5-Methyl-2-pyridinecarbonitrile 1-oxide (CAS: 159727-87-4)?

Answer

5-Methyl-2-pyridinecarbonitrile 1-oxide
5-Methyl-2-pyridinecarbonitrile 1-oxide is primarily used in pharmaceutical research for the synthesis of various compounds. It is also used in organic synthesis and as a reagent in chemical reactions.

About

English Name 5-Methyl-2-pyridinecarbonitrile 1-oxide
Molecular Formula C7H6N2O
Molecular Weight 17.031 g/mol
SMILES CC1=C[N+](=C(C=C1)C#N)[O-]
InChIKey UBYIZILZMDHIBP-UHFFFAOYSA-N
Last Updated: 2026-01-03 15:45

Related Q&A

Compound Q&A

What is 5-Methyl-2-pyridinecarbonitrile 1-oxide (CAS: 159727-87-4)?

5-Methyl-2-pyridinecarbonitrile 1-oxide is an organic compound with the chemical formula C8H7NO2. It...

Compound Q&A

Is 5-Methyl-2-pyridinecarbonitrile 1-oxide (CAS: 159727-87-4) safe?

5-Methyl-2-pyridinecarbonitrile 1-oxide is generally safe when handled with proper precautions. Howe...

Compound Q&A

How should 5-Methyl-2-pyridinecarbonitrile 1-oxide (CAS: 159727-87-4) be stored?

5-Methyl-2-pyridinecarbonitrile 1-oxide should be stored in a cool, dry place away from direct sunli...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...