Compound Q&A

What is 1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine (CAS: 933989-32-3)?

Answer

1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine
1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine is a chemical compound with the CAS number 933989-32-3. It is a white to off-white solid with a molecular weight of approximately 346.37 g/mol. This compound is characterized by its ability to form hydrogen bonds and has a melting point around 162-163°C. It is used in various applications such as pharmaceuticals and research due to its unique chemical structure.

About

English Name 1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine
Molecular Formula C11H16N2O3S
Molecular Weight 256.32699999999994 g/mol
SMILES C1COCCN1S(=O)(=O)C2=CC=CC(=C2)CN
InChIKey PYSTYMQELDDEMC-UHFFFAOYSA-N
Last Updated: 2026-01-03 08:41

Related Q&A

Compound Q&A

What are the main uses of 1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine (CAS: 933989-32-3)?

1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine (CAS: 933989-32-3) is primarily used in the pharmaceu...

Compound Q&A

Is 1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine (CAS: 933989-32-3) safe?

1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine (CAS: 933989-32-3) is generally safe when handled app...

Compound Q&A

How should 1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine (CAS: 933989-32-3) be stored?

1-[3-(4-Morpholinylsulfonyl)phenyl]methanamine (CAS: 933989-32-3) should be stored in a cool, dry pl...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...