Compound Q&A

Is 6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2) safe?

Answer

6-(Trifluoromethyl)-2-quinolinecarboxylic acid
6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2) is generally safe when handled with proper precautions. It is important to use appropriate personal protective equipment (PPE) such as gloves and goggles. Ensure good ventilation and avoid contact with skin and eyes. Storage and use should be in a well-ventilated area away from heat sources and ignition.

About

English Name 6-(Trifluoromethyl)-2-quinolinecarboxylic acid
Molecular Formula C11H6F3NO2
Molecular Weight 241.16799999999998 g/mol
SMILES C1=CC2=C(C=CC(=N2)C(=O)O)C=C1C(F)(F)F
InChIKey LSVFVSVUKCIBHC-UHFFFAOYSA-N
Last Updated: 2026-01-03 05:32

Related Q&A

Compound Q&A

What is 6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2)?

6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2) is an aromatic carboxylic acid wit...

Compound Q&A

What are the main uses of 6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2)?

6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2) is primarily used as a precursor i...

Compound Q&A

How should 6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2) be stored?

6-(Trifluoromethyl)-2-quinolinecarboxylic acid (CAS: 849818-58-2) should be stored in a cool, dry pl...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...