Compound Q&A

What industries use ETHYL ORANGE (CAS: 13545-67-0)?

Answer

ETHYL ORANGE is used in various industries, including pharmaceuticals for coloration and as an intermediate in the synthesis of other compounds, sensors for detecting specific chemical species, and semiconductors for doping purposes. It is also utilized in polymer science for dyeing and coloring applications.

About

CAS No 13545-67-0

English Name ETHYL ORANGE

Molecular Formula C16H18KN3O3S

Molecular Weight 371.5 g/mol

SMILES CCN(CC)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)S(=O)(=O)[O-].[K+]

InChIKey YYVJVQBUGBAHJC-UHFFFAOYSA-M

Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of ETHYL ORANGE (CAS: 13545-67-0)?

ETHYL ORANGE is a crystalline compound with a molecular weight of approximately 134.17 g/mol. It has...

Compound Q&A

How is ETHYL ORANGE (CAS: 13545-67-0) typically synthesized?

ETHYL ORANGE is commonly synthesized via the condensation of phenol and acetylacetone in the presenc...

Compound Q&A

What precautions should be taken when handling ETHYL ORANGE (CAS: 13545-67-0)?

Handling ETHYL ORANGE requires caution due to its potential skin and eye irritation. It is recommend...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What industries use ETHYL ORANGE (CAS: 13545-67-0)?

Answer

About

Related Q&A

What are the physical and chemical properties of ETHYL ORANGE (CAS: 13545-67-0)?

How is ETHYL ORANGE (CAS: 13545-67-0) typically synthesized?

What precautions should be taken when handling ETHYL ORANGE (CAS: 13545-67-0)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Hubei Shixing Chemical Co., Ltd.

Shanghai Jixiang Biotechnology Co., Ltd.

Shanghai Hansi Chemical Co., Ltd.

Nanjing DuLai Biotechnology Co., Ltd.

Shanghai Aladdin Bio-Technologies Co., Ltd.

Shanghai Jieshukai Biotechnology Co., Ltd.