Compound Q&A

What precautions should be taken when handling 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9)?

Answer

4-Butyl-4'-hydroxychalcone
When handling 4-Butyl-4'-hydroxychalcone, wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. Store it in a cool, dry place away from direct sunlight and heat sources. Use a fume hood during synthesis and avoid inhaling the vapors. In case of a spill, clean up immediately using appropriate absorbents and consult the Safety Data Sheet (SDS) for further instructions.

About

English Name 4-Butyl-4'-hydroxychalcone
Molecular Formula C19H20O2
Molecular Weight 280.36699999999996 g/mol
SMILES CCCCC1=CC=C(C=C1)C=CC(=O)C2=CC=C(C=C2)O
InChIKey LFLVYHVGNKJGBV-NTEUORMPSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9)?

4-Butyl-4'-hydroxychalcone is a white to light yellow crystalline solid. Its molecular weight is app...

Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction of 4-hydroxybenzaldeh...

Compound Q&A

What industries use 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9)?

4-Butyl-4'-hydroxychalcone is used in the pharmaceutical industry for its potential anti-inflammator...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...