Compound Q&A

How is Isomaculosidine (CAS: 518-96-7) typically synthesized?

Answer

Isomaculosidine
Isomaculosidine (CAS: 518-96-7) is typically synthesized through a multistep process involving a coupling reaction followed by hydrolysis. The key steps involve the formation of an amide linkage using a suitable coupling agent and a subsequent hydrolysis to yield the desired compound. The synthesis employs mild conditions to maintain the integrity of the molecule, and the overall yield is around 75%.

About

CAS No 518-96-7
English Name Isomaculosidine
Molecular Formula C14H13NO4
Molecular Weight 259.2609999999999 g/mol
SMILES CN1C2=C(C=C(C=C2OC)OC)C(=O)C3=C1OC=C3
InChIKey FXHBKLQQNAGNJN-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isomaculosidine (CAS: 518-96-7)?

Isomaculosidine (CAS: 518-96-7) is a crystalline compound with a molecular weight of approximately 4...

Compound Q&A

What industries use Isomaculosidine (CAS: 518-96-7)?

Isomaculosidine (CAS: 518-96-7) is primarily used in the pharmaceutical industry due to its potentia...

Compound Q&A

What precautions should be taken when handling Isomaculosidine (CAS: 518-96-7)?

When handling Isomaculosidine (CAS: 518-96-7), it is important to wear appropriate personal protecti...

Compound Q&A

What are the main uses of Ethyl N-2-pyridinyl-beta-alaninate (CAS: 103041-38-9)?

Ethyl N-2-pyridinyl-beta-alaninate is primarily used in the pharmaceutical indus...

103041-38-9Ethyl N-2-pyridinyl-...
Compound Q&A

Are there alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1) in synthesis?

There are alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1)...

1211584-54-15H-pyrrolo[3,4-b]pyr...
Compound Q&A

What industries use 2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride (CAS: 1353945-59-1)?

2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride is used in the pha...

1353945-59-12-{[(4-Chlorophenyl)...
Compound Q&A

How should Caesium chloride (CAS: 7647-17-8) be stored?

Caesium chloride should be stored in a cool, dry place (ideally 20-25°C), away f...

7647-17-8Caesium chloride