Compound Q&A

How is Tanshindiol A (CAS: 97411-46-6) typically synthesized?

Answer

Tanshindiol A
Tanshindiol A (CAS: 97411-46-6) is typically synthesized via a multi-step process starting from natural precursors such as tanshinone I. Common synthetic routes involve oxidation and cyclization reactions. The use of metal catalysts like Pd or Ru can enhance selectivity and yield. The overall process requires precise control of reaction conditions to achieve high purity.

About

CAS No 97411-46-6
English Name Tanshindiol A
Molecular Formula C18H16O5
Molecular Weight 312.321 g/mol
SMILES CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(CO)O
InChIKey TZHMQUSSYNZSTA-GOSISDBHSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tanshindiol A (CAS: 97411-46-6)?

Tanshindiol A (CAS: 97411-46-6) is a crystalline compound with a molecular weight of approximately 2...

Compound Q&A

What industries use Tanshindiol A (CAS: 97411-46-6)?

Tanshindiol A (CAS: 97411-46-6) is widely used in the pharmaceutical industry for its potential anti...

Compound Q&A

What precautions should be taken when handling Tanshindiol A (CAS: 97411-46-6)?

When handling Tanshindiol A (CAS: 97411-46-6), appropriate personal protective equipment (PPE) such ...

Compound Q&A

What are the main uses of 2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile (CAS: 70291-62-2)?

2-Amino-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carbonitrile is primarily used a...

70291-62-22-Amino-5,6-dihydro-...
Compound Q&A

What industries use Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7)?

Methyl 5-ethoxy-2-pyridinecarboxylate (CAS: 941306-58-7) is primarily used in th...

941306-58-7Methyl 5-ethoxy-2-py...
Compound Q&A

How is 4-Butyl-4'-hydroxychalcone (CAS: 385810-21-9) typically synthesized?

4-Butyl-4'-hydroxychalcone is commonly synthesized via a condensation reaction o...

385810-21-94-Butyl-4'-hydroxych...
Compound Q&A

What is 8-Bromo-4-methylquinoline (CAS: 172939-50-3)?

8-Bromo-4-methylquinoline is a chemical compound with the CAS number 172939-50-3...

172939-50-38-Bromo-4-methylquin...